C9H7F9O3 — CID 59741487
3-[difluoro(oxolan-2-yl)methoxy]-1,1,1,3,4,4,4-heptafluorobutan-2-one (PubChem CID 59741487) has the molecular formula C9H7F9O3 and a molecular weight of 334.13 g/mol. Its IUPAC name is 3-[difluoro(oxolan-2-yl)methoxy]-1,1,1,3,4,4,4-heptafluorobutan-2-one.
| Compound Name | 3-[difluoro(oxolan-2-yl)methoxy]-1,1,1,3,4,4,4-heptafluorobutan-2-one |
|---|---|
| PubChem CID | 59741487 |
| Molecular Formula | C9H7F9O3 |
| Molecular Weight | 334.13 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 3-[difluoro(oxolan-2-yl)methoxy]-1,1,1,3,4,4,4-heptafluorobutan-2-one |
| SMILES | O=C(C(F)(F)F)C(F)(OC(F)(F)C1CCCO1)C(F)(F)F |
| InChI | InChI=1S/C9H7F9O3/c10-6(9(16,17)18,5(19)7(11,12)13)21-8(14,15)4-2-1-3-20-4/h4H,1-3H2 |
| InChIKey | QXEXCIUQQRVCBO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.13 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |