C8H9F7O3 — CID 130284264
2-[difluoro-[1,2,2,2-tetrafluoro-1-(fluoromethoxy)ethoxy]methyl]oxolane (PubChem CID 130284264) has the molecular formula C8H9F7O3 and a molecular weight of 286.14 g/mol. Its IUPAC name is 2-[difluoro-[1,2,2,2-tetrafluoro-1-(fluoromethoxy)ethoxy]methyl]oxolane.
| Compound Name | 2-[difluoro-[1,2,2,2-tetrafluoro-1-(fluoromethoxy)ethoxy]methyl]oxolane |
|---|---|
| PubChem CID | 130284264 |
| Molecular Formula | C8H9F7O3 |
| Molecular Weight | 286.14 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 2-[difluoro-[1,2,2,2-tetrafluoro-1-(fluoromethoxy)ethoxy]methyl]oxolane |
| SMILES | FCOC(F)(OC(F)(F)C1CCCO1)C(F)(F)F |
| InChI | InChI=1S/C8H9F7O3/c9-4-17-8(15,7(12,13)14)18-6(10,11)5-2-1-3-16-5/h5H,1-4H2 |
| InChIKey | RMRUKONVQKFZHQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.14 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|