C10H11F9O — CID 139743782
2-(1,1,2,2,3,3,6,6,6-nonafluorohexyl)oxolane (PubChem CID 139743782) has the molecular formula C10H11F9O and a molecular weight of 318.18 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,6,6,6-nonafluorohexyl)oxolane.
| Compound Name | 2-(1,1,2,2,3,3,6,6,6-nonafluorohexyl)oxolane |
|---|---|
| PubChem CID | 139743782 |
| Molecular Formula | C10H11F9O |
| Molecular Weight | 318.18 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 2-(1,1,2,2,3,3,6,6,6-nonafluorohexyl)oxolane |
| SMILES | FC(F)(F)CCC(F)(F)C(F)(F)C(F)(F)C1CCCO1 |
| InChI | InChI=1S/C10H11F9O/c11-7(12,3-4-8(13,14)15)10(18,19)9(16,17)6-2-1-5-20-6/h6H,1-5H2 |
| InChIKey | XEXUTFHJYJNJOQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.18 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|