C6HF11O2 — CID 91152091
1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl formate (PubChem CID 91152091) has the molecular formula C6HF11O2 and a molecular weight of 314.05 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl formate.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl formate |
|---|---|
| PubChem CID | 91152091 |
| Molecular Formula | C6HF11O2 |
| Molecular Weight | 314.05 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl formate |
| SMILES | O=COC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6HF11O2/c7-2(8,3(9,10)5(13,14)15)4(11,12)6(16,17)19-1-18/h1H |
| InChIKey | PXGWZUUEKVVNOO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.05 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|