C7HF13O2 — CID 91133971
1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl formate (PubChem CID 91133971) has the molecular formula C7HF13O2 and a molecular weight of 364.06 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl formate.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl formate |
|---|---|
| PubChem CID | 91133971 |
| Molecular Formula | C7HF13O2 |
| Molecular Weight | 364.06 g/mol |
| Exact Mass | 363.98 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl formate |
| SMILES | O=COC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7HF13O2/c8-2(9,4(12,13)6(16,17)18)3(10,11)5(14,15)7(19,20)22-1-21/h1H |
| InChIKey | MDVQAFZQCLCZJA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.06 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|