C9HF15O4 — CID 20760912
[1,1,1,3,3,4,4-heptafluoro-4-formyloxy-2-(trifluoromethyl)butan-2-yl] 2,2,3,3,3-pentafluoropropanoate (PubChem CID 20760912) has the molecular formula C9HF15O4 and a molecular weight of 458.07 g/mol. Its IUPAC name is [1,1,1,3,3,4,4-heptafluoro-4-formyloxy-2-(trifluoromethyl)butan-2-yl] 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | [1,1,1,3,3,4,4-heptafluoro-4-formyloxy-2-(trifluoromethyl)butan-2-yl] 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 20760912 |
| Molecular Formula | C9HF15O4 |
| Molecular Weight | 458.07 g/mol |
| Exact Mass | 457.96 |
| IUPAC Name | [1,1,1,3,3,4,4-heptafluoro-4-formyloxy-2-(trifluoromethyl)butan-2-yl] 2,2,3,3,3-pentafluoropropanoate |
| SMILES | O=COC(F)(F)C(F)(F)C(OC(=O)C(F)(F)C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9HF15O4/c10-3(11,6(14,15)16)2(26)28-4(7(17,18)19,8(20,21)22)5(12,13)9(23,24)27-1-25/h1H |
| InChIKey | REICKRMQVOQEEK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.07 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|