C3F8O2Si — CID 23235509
trifluorosilyl 2,2,3,3,3-pentafluoropropanoate (PubChem CID 23235509) has the molecular formula C3F8O2Si and a molecular weight of 248.10 g/mol. Its IUPAC name is trifluorosilyl 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | trifluorosilyl 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 23235509 |
| Molecular Formula | C3F8O2Si |
| Molecular Weight | 248.10 g/mol |
| Exact Mass | 247.95 |
| IUPAC Name | trifluorosilyl 2,2,3,3,3-pentafluoropropanoate |
| SMILES | O=C(O[Si](F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C3F8O2Si/c4-2(5,3(6,7)8)1(12)13-14(9,10)11 |
| InChIKey | CBGRKELPQRSTCZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.10 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|