C4F8O4S — CID 151360600
trifluoromethylsulfonyl 2,2,3,3,3-pentafluoropropanoate (PubChem CID 151360600) has the molecular formula C4F8O4S and a molecular weight of 296.09 g/mol. Its IUPAC name is trifluoromethylsulfonyl 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | trifluoromethylsulfonyl 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 151360600 |
| Molecular Formula | C4F8O4S |
| Molecular Weight | 296.09 g/mol |
| Exact Mass | 295.94 |
| IUPAC Name | trifluoromethylsulfonyl 2,2,3,3,3-pentafluoropropanoate |
| SMILES | O=C(OS(=O)(=O)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4F8O4S/c5-2(6,3(7,8)9)1(13)16-17(14,15)4(10,11)12 |
| InChIKey | OOJXTGWZZXCYAS-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.09 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|