C10H10F6N2O4S — CID 89407045
N,N-dimethylpyridin-2-amine;trifluoromethylsulfonyl 2,2,2-trifluoroacetate (PubChem CID 89407045) has the molecular formula C10H10F6N2O4S and a molecular weight of 368.26 g/mol. Its IUPAC name is N,N-dimethylpyridin-2-amine;trifluoromethylsulfonyl 2,2,2-trifluoroacetate.
| Compound Name | N,N-dimethylpyridin-2-amine;trifluoromethylsulfonyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 89407045 |
| Molecular Formula | C10H10F6N2O4S |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | N,N-dimethylpyridin-2-amine;trifluoromethylsulfonyl 2,2,2-trifluoroacetate |
| SMILES | CN(C)c1ccccn1.O=C(OS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H10N2.C3F6O4S/c1-9(2)7-5-3-4-6-8-7;4-2(5,6)1(10)13-14(11,12)3(7,8)9/h3-6H,1-2H3; |
| InChIKey | REGXGEQWBQCWOY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|