C7H12N2 — CID 143283394
N,N-dimethylpyridin-2-amine;molecular hydrogen (PubChem CID 143283394) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is N,N-dimethylpyridin-2-amine;molecular hydrogen.
| Compound Name | N,N-dimethylpyridin-2-amine;molecular hydrogen |
|---|---|
| PubChem CID | 143283394 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | N,N-dimethylpyridin-2-amine;molecular hydrogen |
| SMILES | CN(C)c1ccccn1.[H][H] |
| InChI | InChI=1S/C7H10N2.H2/c1-9(2)7-5-3-4-6-8-7;/h3-6H,1-2H3;1H |
| InChIKey | GKCSTVJJJGJQDP-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |