N,N-dimethylpyridin-2-amine;molecular hydrogen

C7H12N2 — CID 143283394

IUPACN,N-dimethylpyridin-2-amine;molecular hydrogen
SMILESCN(C)c1ccccn1.[H][H]
InChIInChI=1S/C7H10N2.H2/c1-9(2)7-5-3-4-6-8-7;/h3-6H,1-2H3;1H
InChIKeyGKCSTVJJJGJQDP-UHFFFAOYSA-N
MW124.19 g/mol
LogP1.39
Rot. Bonds1

About N,N-dimethylpyridin-2-amine;molecular hydrogen

N,N-dimethylpyridin-2-amine;molecular hydrogen (PubChem CID 143283394) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is N,N-dimethylpyridin-2-amine;molecular hydrogen.

Molecular Properties

Compound NameN,N-dimethylpyridin-2-amine;molecular hydrogen
PubChem CID143283394
Molecular FormulaC7H12N2
Molecular Weight124.19 g/mol
Exact Mass124.10
IUPAC NameN,N-dimethylpyridin-2-amine;molecular hydrogen
SMILESCN(C)c1ccccn1.[H][H]
InChIInChI=1S/C7H10N2.H2/c1-9(2)7-5-3-4-6-8-7;/h3-6H,1-2H3;1H
InChIKeyGKCSTVJJJGJQDP-UHFFFAOYSA-N
XLogP1.39
TPSA16.13 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500124.19
LogP ≤ 51.39
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze N,N-dimethylpyridin-2-amine;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N,N-dimethylpyridin-2-amine;molecular hydrogen?
The IUPAC name of N,N-dimethylpyridin-2-amine;molecular hydrogen (CID 143283394) is N,N-dimethylpyridin-2-amine;molecular hydrogen.
What is the SMILES notation for N,N-dimethylpyridin-2-amine;molecular hydrogen?
The canonical SMILES for N,N-dimethylpyridin-2-amine;molecular hydrogen is CN(C)c1ccccn1.[H][H].
What is the InChIKey of N,N-dimethylpyridin-2-amine;molecular hydrogen?
The InChIKey is GKCSTVJJJGJQDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.H2/c1-9(2)7-5-3-4-6-8-7;/h3-6H,1-2H3;1H.
What are the key properties of N,N-dimethylpyridin-2-amine;molecular hydrogen?
N,N-dimethylpyridin-2-amine;molecular hydrogen has a molecular weight of 124.19 g/mol, XLogP of 1.39, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylpyridin-2-amine;molecular hydrogen is sourced from PubChem (CID 143283394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).