C5H6N2S2 — CID 89305053
N,N-bis(sulfanyl)pyridin-2-amine (PubChem CID 89305053) has the molecular formula C5H6N2S2 and a molecular weight of 158.25 g/mol. Its IUPAC name is N,N-bis(sulfanyl)pyridin-2-amine.
| Compound Name | N,N-bis(sulfanyl)pyridin-2-amine |
|---|---|
| PubChem CID | 89305053 |
| Molecular Formula | C5H6N2S2 |
| Molecular Weight | 158.25 g/mol |
| Exact Mass | 158.00 |
| IUPAC Name | N,N-bis(sulfanyl)pyridin-2-amine |
| SMILES | SN(S)c1ccccn1 |
| InChI | InChI=1S/C5H6N2S2/c8-7(9)5-3-1-2-4-6-5/h1-4,8-9H |
| InChIKey | NAUKHVCZDNZZOC-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 16.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|