C25H25BN2 — CID 157357235
N,N-dimethylpyridin-2-amine;triphenylborane (PubChem CID 157357235) has the molecular formula C25H25BN2 and a molecular weight of 364.30 g/mol. Its IUPAC name is N,N-dimethylpyridin-2-amine;triphenylborane.
| Compound Name | N,N-dimethylpyridin-2-amine;triphenylborane |
|---|---|
| PubChem CID | 157357235 |
| Molecular Formula | C25H25BN2 |
| Molecular Weight | 364.30 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | N,N-dimethylpyridin-2-amine;triphenylborane |
| SMILES | CN(C)c1ccccn1.c1ccc(B(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15B.C7H10N2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-9(2)7-5-3-4-6-8-7/h1-15H;3-6H,1-2H3 |
| InChIKey | BIFQBXFZIXURNB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|