C5F10O2 — CID 87267388
[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] carbonofluoridate (PubChem CID 87267388) has the molecular formula C5F10O2 and a molecular weight of 282.03 g/mol. Its IUPAC name is [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] carbonofluoridate.
| Compound Name | [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] carbonofluoridate |
|---|---|
| PubChem CID | 87267388 |
| Molecular Formula | C5F10O2 |
| Molecular Weight | 282.03 g/mol |
| Exact Mass | 281.97 |
| IUPAC Name | [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] carbonofluoridate |
| SMILES | O=C(F)OC(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5F10O2/c6-1(16)17-2(3(7,8)9,4(10,11)12)5(13,14)15 |
| InChIKey | RVNVRKQXNXUZQS-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.03 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|