C5F10O3 — CID 172810200
[1,1,1,3,3,3-hexafluoro-2-(trifluoromethoxy)propan-2-yl] carbonofluoridate (PubChem CID 172810200) has the molecular formula C5F10O3 and a molecular weight of 298.03 g/mol. Its IUPAC name is [1,1,1,3,3,3-hexafluoro-2-(trifluoromethoxy)propan-2-yl] carbonofluoridate.
| Compound Name | [1,1,1,3,3,3-hexafluoro-2-(trifluoromethoxy)propan-2-yl] carbonofluoridate |
|---|---|
| PubChem CID | 172810200 |
| Molecular Formula | C5F10O3 |
| Molecular Weight | 298.03 g/mol |
| Exact Mass | 297.97 |
| IUPAC Name | [1,1,1,3,3,3-hexafluoro-2-(trifluoromethoxy)propan-2-yl] carbonofluoridate |
| SMILES | O=C(F)OC(OC(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5F10O3/c6-1(16)17-2(3(7,8)9,4(10,11)12)18-5(13,14)15 |
| InChIKey | SBLKHTJXNYCYDI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.03 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|