C6F12O3 — CID 175723871
2,2-difluoro-2-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]acetyl fluoride (PubChem CID 175723871) has the molecular formula C6F12O3 and a molecular weight of 348.04 g/mol. Its IUPAC name is 2,2-difluoro-2-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]acetyl fluoride.
| Compound Name | 2,2-difluoro-2-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]acetyl fluoride |
|---|---|
| PubChem CID | 175723871 |
| Molecular Formula | C6F12O3 |
| Molecular Weight | 348.04 g/mol |
| Exact Mass | 347.97 |
| IUPAC Name | 2,2-difluoro-2-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]acetyl fluoride |
| SMILES | O=C(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)OC(F)(F)F |
| InChI | InChI=1S/C6F12O3/c7-1(19)2(8,9)20-4(12,13)3(10,11)5(14,15)21-6(16,17)18 |
| InChIKey | ZUZNDFQVJWSHNY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.04 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|