C6H3F11O3 — CID 66573360
2,2-difluoro-2-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]ethanol (PubChem CID 66573360) has the molecular formula C6H3F11O3 and a molecular weight of 332.07 g/mol. Its IUPAC name is 2,2-difluoro-2-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]ethanol.
| Compound Name | 2,2-difluoro-2-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]ethanol |
|---|---|
| PubChem CID | 66573360 |
| Molecular Formula | C6H3F11O3 |
| Molecular Weight | 332.07 g/mol |
| Exact Mass | 331.99 |
| IUPAC Name | 2,2-difluoro-2-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]ethanol |
| SMILES | OCC(F)(F)OC(F)(F)C(F)(F)C(F)(F)OC(F)(F)F |
| InChI | InChI=1S/C6H3F11O3/c7-2(8,1-18)19-4(11,12)3(9,10)5(13,14)20-6(15,16)17/h18H,1H2 |
| InChIKey | ADFHLSYJQXYQSD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.07 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|