C15H17F15O3 — CID 130331500
2,2-difluoro-2-[1,1,2,2-tetrafluoro-3-methyl-1-(3,3,4,4,5,5,6,6,6-nonafluoro-2-methylhexan-2-yl)oxypentan-3-yl]oxyethanol (PubChem CID 130331500) has the molecular formula C15H17F15O3 and a molecular weight of 530.27 g/mol. Its IUPAC name is 2,2-difluoro-2-[1,1,2,2-tetrafluoro-3-methyl-1-(3,3,4,4,5,5,6,6,6-nonafluoro-2-methylhexan-2-yl)oxypentan-3-yl]oxyethanol.
| Compound Name | 2,2-difluoro-2-[1,1,2,2-tetrafluoro-3-methyl-1-(3,3,4,4,5,5,6,6,6-nonafluoro-2-methylhexan-2-yl)oxypentan-3-yl]oxyethanol |
|---|---|
| PubChem CID | 130331500 |
| Molecular Formula | C15H17F15O3 |
| Molecular Weight | 530.27 g/mol |
| Exact Mass | 530.09 |
| IUPAC Name | 2,2-difluoro-2-[1,1,2,2-tetrafluoro-3-methyl-1-(3,3,4,4,5,5,6,6,6-nonafluoro-2-methylhexan-2-yl)oxypentan-3-yl]oxyethanol |
| SMILES | CCC(C)(OC(F)(F)CO)C(F)(F)C(F)(F)OC(C)(C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H17F15O3/c1-5-8(4,33-9(16,17)6-31)11(20,21)15(29,30)32-7(2,3)10(18,19)12(22,23)13(24,25)14(26,27)28/h31H,5-6H2,1-4H3 |
| InChIKey | ZRUQMCUGWUQKFZ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.27 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|