C11H17F7O3 — CID 155219958
3-methyl-3-[1,1,2,2-tetrafluoro-3-methyl-3-(trifluoromethoxy)butoxy]butan-1-ol (PubChem CID 155219958) has the molecular formula C11H17F7O3 and a molecular weight of 330.24 g/mol. Its IUPAC name is 3-methyl-3-[1,1,2,2-tetrafluoro-3-methyl-3-(trifluoromethoxy)butoxy]butan-1-ol.
| Compound Name | 3-methyl-3-[1,1,2,2-tetrafluoro-3-methyl-3-(trifluoromethoxy)butoxy]butan-1-ol |
|---|---|
| PubChem CID | 155219958 |
| Molecular Formula | C11H17F7O3 |
| Molecular Weight | 330.24 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 3-methyl-3-[1,1,2,2-tetrafluoro-3-methyl-3-(trifluoromethoxy)butoxy]butan-1-ol |
| SMILES | CC(C)(CCO)OC(F)(F)C(F)(F)C(C)(C)OC(F)(F)F |
| InChI | InChI=1S/C11H17F7O3/c1-7(2,5-6-19)20-10(14,15)9(12,13)8(3,4)21-11(16,17)18/h19H,5-6H2,1-4H3 |
| InChIKey | NMCKEZDBWUUAOH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.24 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|