C11H20F6N2O2 — CID 135202365
2-[3-(2-amino-1,1-difluoroethoxy)-1,1,2,2-tetrafluoro-3-methylbutoxy]-2-methylpropan-1-amine (PubChem CID 135202365) has the molecular formula C11H20F6N2O2 and a molecular weight of 326.28 g/mol. Its IUPAC name is 2-[3-(2-amino-1,1-difluoroethoxy)-1,1,2,2-tetrafluoro-3-methylbutoxy]-2-methylpropan-1-amine.
| Compound Name | 2-[3-(2-amino-1,1-difluoroethoxy)-1,1,2,2-tetrafluoro-3-methylbutoxy]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 135202365 |
| Molecular Formula | C11H20F6N2O2 |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 2-[3-(2-amino-1,1-difluoroethoxy)-1,1,2,2-tetrafluoro-3-methylbutoxy]-2-methylpropan-1-amine |
| SMILES | CC(C)(CN)OC(F)(F)C(F)(F)C(C)(C)OC(F)(F)CN |
| InChI | InChI=1S/C11H20F6N2O2/c1-7(2,5-18)20-11(16,17)10(14,15)8(3,4)21-9(12,13)6-19/h5-6,18-19H2,1-4H3 |
| InChIKey | HWJQCGAIGRQKKG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|