C9H12F6O4 — CID 118458046
[2,2-difluoro-2-(3,3,4,4-tetrafluoro-4-hydroxy-2-methylbutan-2-yl)oxyethyl] acetate (PubChem CID 118458046) has the molecular formula C9H12F6O4 and a molecular weight of 298.18 g/mol. Its IUPAC name is [2,2-difluoro-2-(3,3,4,4-tetrafluoro-4-hydroxy-2-methylbutan-2-yl)oxyethyl] acetate.
| Compound Name | [2,2-difluoro-2-(3,3,4,4-tetrafluoro-4-hydroxy-2-methylbutan-2-yl)oxyethyl] acetate |
|---|---|
| PubChem CID | 118458046 |
| Molecular Formula | C9H12F6O4 |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | [2,2-difluoro-2-(3,3,4,4-tetrafluoro-4-hydroxy-2-methylbutan-2-yl)oxyethyl] acetate |
| SMILES | CC(=O)OCC(F)(F)OC(C)(C)C(F)(F)C(O)(F)F |
| InChI | InChI=1S/C9H12F6O4/c1-5(16)18-4-7(10,11)19-6(2,3)8(12,13)9(14,15)17/h17H,4H2,1-3H3 |
| InChIKey | BLLWLYYVYGLPGQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|