C8H14F2O5S — CID 158265529
3-acetyloxy-1,1-difluoro-2,2-dimethylpropane-1-sulfonate;carbanylium (PubChem CID 158265529) has the molecular formula C8H14F2O5S and a molecular weight of 260.26 g/mol. Its IUPAC name is 3-acetyloxy-1,1-difluoro-2,2-dimethylpropane-1-sulfonate;carbanylium.
| Compound Name | 3-acetyloxy-1,1-difluoro-2,2-dimethylpropane-1-sulfonate;carbanylium |
|---|---|
| PubChem CID | 158265529 |
| Molecular Formula | C8H14F2O5S |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 3-acetyloxy-1,1-difluoro-2,2-dimethylpropane-1-sulfonate;carbanylium |
| SMILES | CC(=O)OCC(C)(C)C(F)(F)S(=O)(=O)[O-].[CH3+] |
| InChI | InChI=1S/C7H12F2O5S.CH3/c1-5(10)14-4-6(2,3)7(8,9)15(11,12)13;/h4H2,1-3H3,(H,11,12,13);1H3/q;+1/p-1 |
| InChIKey | GIJVALHOFVTBGM-UHFFFAOYSA-M |
| XLogP | 1.16 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|