C14H23F7O2 — CID 134576174
2,2,4-trimethyl-4-[1,1,2,2-tetrafluoro-2-(1,1,1-trifluoro-2-methylpropan-2-yl)oxyethoxy]pentane (PubChem CID 134576174) has the molecular formula C14H23F7O2 and a molecular weight of 356.32 g/mol. Its IUPAC name is 2,2,4-trimethyl-4-[1,1,2,2-tetrafluoro-2-(1,1,1-trifluoro-2-methylpropan-2-yl)oxyethoxy]pentane.
| Compound Name | 2,2,4-trimethyl-4-[1,1,2,2-tetrafluoro-2-(1,1,1-trifluoro-2-methylpropan-2-yl)oxyethoxy]pentane |
|---|---|
| PubChem CID | 134576174 |
| Molecular Formula | C14H23F7O2 |
| Molecular Weight | 356.32 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 2,2,4-trimethyl-4-[1,1,2,2-tetrafluoro-2-(1,1,1-trifluoro-2-methylpropan-2-yl)oxyethoxy]pentane |
| SMILES | CC(C)(C)CC(C)(C)OC(F)(F)C(F)(F)OC(C)(C)C(F)(F)F |
| InChI | InChI=1S/C14H23F7O2/c1-9(2,3)8-10(4,5)22-13(18,19)14(20,21)23-11(6,7)12(15,16)17/h8H2,1-7H3 |
| InChIKey | ZXNPPNNHUZJWPE-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.32 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|