C24H48O3 — CID 145316987
[2,4-dimethyl-4-(2,4,4-trimethylpentan-2-yloxy)pentan-2-yl] 2,2,4,4-tetramethylpentanoate (PubChem CID 145316987) has the molecular formula C24H48O3 and a molecular weight of 384.65 g/mol. Its IUPAC name is [2,4-dimethyl-4-(2,4,4-trimethylpentan-2-yloxy)pentan-2-yl] 2,2,4,4-tetramethylpentanoate.
| Compound Name | [2,4-dimethyl-4-(2,4,4-trimethylpentan-2-yloxy)pentan-2-yl] 2,2,4,4-tetramethylpentanoate |
|---|---|
| PubChem CID | 145316987 |
| Molecular Formula | C24H48O3 |
| Molecular Weight | 384.65 g/mol |
| Exact Mass | 384.36 |
| IUPAC Name | [2,4-dimethyl-4-(2,4,4-trimethylpentan-2-yloxy)pentan-2-yl] 2,2,4,4-tetramethylpentanoate |
| SMILES | CC(C)(C)CC(C)(C)OC(C)(C)CC(C)(C)OC(=O)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C24H48O3/c1-19(2,3)15-21(7,8)18(25)26-22(9,10)17-24(13,14)27-23(11,12)16-20(4,5)6/h15-17H2,1-14H3 |
| InChIKey | OIQCLGOUVWQELU-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.65 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |