C21H40O5 — CID 154107476
2,4,4-trimethylpentan-2-yl 2,2-dimethyl-3-oxo-3-(2,4,4-trimethylpentan-2-ylperoxy)propanoate (PubChem CID 154107476) has the molecular formula C21H40O5 and a molecular weight of 372.55 g/mol. Its IUPAC name is 2,4,4-trimethylpentan-2-yl 2,2-dimethyl-3-oxo-3-(2,4,4-trimethylpentan-2-ylperoxy)propanoate.
| Compound Name | 2,4,4-trimethylpentan-2-yl 2,2-dimethyl-3-oxo-3-(2,4,4-trimethylpentan-2-ylperoxy)propanoate |
|---|---|
| PubChem CID | 154107476 |
| Molecular Formula | C21H40O5 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.29 |
| IUPAC Name | 2,4,4-trimethylpentan-2-yl 2,2-dimethyl-3-oxo-3-(2,4,4-trimethylpentan-2-ylperoxy)propanoate |
| SMILES | CC(C)(C)CC(C)(C)OOC(=O)C(C)(C)C(=O)OC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C21H40O5/c1-17(2,3)13-19(7,8)24-15(22)21(11,12)16(23)25-26-20(9,10)14-18(4,5)6/h13-14H2,1-12H3 |
| InChIKey | FAZAKJNQOLXLPN-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|