C14H24O4 — CID 54405224
2,4,4-trimethylpentan-2-yloxy hexa-2,4-dieneperoxoate (PubChem CID 54405224) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is 2,4,4-trimethylpentan-2-yloxy hexa-2,4-dieneperoxoate.
| Compound Name | 2,4,4-trimethylpentan-2-yloxy hexa-2,4-dieneperoxoate |
|---|---|
| PubChem CID | 54405224 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 2,4,4-trimethylpentan-2-yloxy hexa-2,4-dieneperoxoate |
| SMILES | CC=CC=CC(=O)OOOC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C14H24O4/c1-7-8-9-10-12(15)16-18-17-14(5,6)11-13(2,3)4/h7-10H,11H2,1-6H3 |
| InChIKey | VQFMRCQUCFUIDX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|