4,5-dioxo-5-(2,4,4-trimethylpentan-2-yloxy)pentanoic acid

C13H22O5 — CID 146231604

IUPAC4,5-dioxo-5-(2,4,4-trimethylpentan-2-yloxy)pentanoic acid
SMILESCC(C)(C)CC(C)(C)OC(=O)C(=O)CCC(=O)O
InChIInChI=1S/C13H22O5/c1-12(2,3)8-13(4,5)18-11(17)9(14)6-7-10(15)16/h6-8H2,1-5H3,(H,15,16)
InChIKeyDHFAUIXUZHESIZ-UHFFFAOYSA-N
MW258.31 g/mol
LogP2.18
Rot. Bonds6

About 4,5-dioxo-5-(2,4,4-trimethylpentan-2-yloxy)pentanoic acid

4,5-dioxo-5-(2,4,4-trimethylpentan-2-yloxy)pentanoic acid (PubChem CID 146231604) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is 4,5-dioxo-5-(2,4,4-trimethylpentan-2-yloxy)pentanoic acid.

Molecular Properties

Compound Name4,5-dioxo-5-(2,4,4-trimethylpentan-2-yloxy)pentanoic acid
PubChem CID146231604
Molecular FormulaC13H22O5
Molecular Weight258.31 g/mol
Exact Mass258.15
IUPAC Name4,5-dioxo-5-(2,4,4-trimethylpentan-2-yloxy)pentanoic acid
SMILESCC(C)(C)CC(C)(C)OC(=O)C(=O)CCC(=O)O
InChIInChI=1S/C13H22O5/c1-12(2,3)8-13(4,5)18-11(17)9(14)6-7-10(15)16/h6-8H2,1-5H3,(H,15,16)
InChIKeyDHFAUIXUZHESIZ-UHFFFAOYSA-N
XLogP2.18
TPSA80.67 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.31
LogP ≤ 52.18
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 4,5-dioxo-5-(2,4,4-trimethylpentan-2-yloxy)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,5-dioxo-5-(2,4,4-trimethylpentan-2-yloxy)pentanoic acid?
The IUPAC name of 4,5-dioxo-5-(2,4,4-trimethylpentan-2-yloxy)pentanoic acid (CID 146231604) is 4,5-dioxo-5-(2,4,4-trimethylpentan-2-yloxy)pentanoic acid.
What is the SMILES notation for 4,5-dioxo-5-(2,4,4-trimethylpentan-2-yloxy)pentanoic acid?
The canonical SMILES for 4,5-dioxo-5-(2,4,4-trimethylpentan-2-yloxy)pentanoic acid is CC(C)(C)CC(C)(C)OC(=O)C(=O)CCC(=O)O.
What is the InChIKey of 4,5-dioxo-5-(2,4,4-trimethylpentan-2-yloxy)pentanoic acid?
The InChIKey is DHFAUIXUZHESIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O5/c1-12(2,3)8-13(4,5)18-11(17)9(14)6-7-10(15)16/h6-8H2,1-5H3,(H,15,16).
What are the key properties of 4,5-dioxo-5-(2,4,4-trimethylpentan-2-yloxy)pentanoic acid?
4,5-dioxo-5-(2,4,4-trimethylpentan-2-yloxy)pentanoic acid has a molecular weight of 258.31 g/mol, XLogP of 2.18, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dioxo-5-(2,4,4-trimethylpentan-2-yloxy)pentanoic acid is sourced from PubChem (CID 146231604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).