C8H12O4 — CID 13213549
6-methyl-4,5-dioxoheptanoic acid (PubChem CID 13213549) has the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. Its IUPAC name is 6-methyl-4,5-dioxoheptanoic acid.
| Compound Name | 6-methyl-4,5-dioxoheptanoic acid |
|---|---|
| PubChem CID | 13213549 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 6-methyl-4,5-dioxoheptanoic acid |
| SMILES | CC(C)C(=O)C(=O)CCC(=O)O |
| InChI | InChI=1S/C8H12O4/c1-5(2)8(12)6(9)3-4-7(10)11/h5H,3-4H2,1-2H3,(H,10,11) |
| InChIKey | XHQMQWTXRXEDIX-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|