About lanthanum;2-oxopentanedioic acid
lanthanum;2-oxopentanedioic acid (PubChem CID 174979483) has the molecular formula C5H6LaO5
and a molecular weight of 285.00 g/mol. Its IUPAC name is lanthanum;2-oxopentanedioic acid.
Molecular Properties
| Compound Name | lanthanum;2-oxopentanedioic acid |
| PubChem CID | 174979483 |
| Molecular Formula | C5H6LaO5 |
| Molecular Weight | 285.00 g/mol |
| Exact Mass | 284.93 |
| IUPAC Name | lanthanum;2-oxopentanedioic acid |
| SMILES | O=C(O)CCC(=O)C(=O)O.[La] |
| InChI | InChI=1S/C5H6O5.La/c6-3(5(9)10)1-2-4(7)8;/h1-2H2,(H,7,8)(H,9,10); |
| InChIKey | ACCOSHBAPUMELG-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.00 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze lanthanum;2-oxopentanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lanthanum;2-oxopentanedioic acid?
The IUPAC name of lanthanum;2-oxopentanedioic acid (CID 174979483) is lanthanum;2-oxopentanedioic acid.
What is the SMILES notation for lanthanum;2-oxopentanedioic acid?
The canonical SMILES for lanthanum;2-oxopentanedioic acid is O=C(O)CCC(=O)C(=O)O.[La].
What is the InChIKey of lanthanum;2-oxopentanedioic acid?
The InChIKey is ACCOSHBAPUMELG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O5.La/c6-3(5(9)10)1-2-4(7)8;/h1-2H2,(H,7,8)(H,9,10);.
What are the key properties of lanthanum;2-oxopentanedioic acid?
lanthanum;2-oxopentanedioic acid has a molecular weight of 285.00 g/mol, XLogP of -0.50, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lanthanum;2-oxopentanedioic acid is sourced from PubChem (CID 174979483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).