C14H24O6 — CID 155009970
5-(5-hydroxy-2,4,5-trimethylhexoxy)-4,5-dioxopentanoic acid (PubChem CID 155009970) has the molecular formula C14H24O6 and a molecular weight of 288.34 g/mol. Its IUPAC name is 5-(5-hydroxy-2,4,5-trimethylhexoxy)-4,5-dioxopentanoic acid.
| Compound Name | 5-(5-hydroxy-2,4,5-trimethylhexoxy)-4,5-dioxopentanoic acid |
|---|---|
| PubChem CID | 155009970 |
| Molecular Formula | C14H24O6 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 5-(5-hydroxy-2,4,5-trimethylhexoxy)-4,5-dioxopentanoic acid |
| SMILES | CC(COC(=O)C(=O)CCC(=O)O)CC(C)C(C)(C)O |
| InChI | InChI=1S/C14H24O6/c1-9(7-10(2)14(3,4)19)8-20-13(18)11(15)5-6-12(16)17/h9-10,19H,5-8H2,1-4H3,(H,16,17) |
| InChIKey | LKAKXNZVPJFRLQ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|