C22H46O6 — CID 175557981
7,7-dimethyloctanoic acid;5-(4-hydroxy-2-methylpentyl)peroxy-4-methylpentan-2-ol (PubChem CID 175557981) has the molecular formula C22H46O6 and a molecular weight of 406.60 g/mol. Its IUPAC name is 7,7-dimethyloctanoic acid;5-(4-hydroxy-2-methylpentyl)peroxy-4-methylpentan-2-ol.
| Compound Name | 7,7-dimethyloctanoic acid;5-(4-hydroxy-2-methylpentyl)peroxy-4-methylpentan-2-ol |
|---|---|
| PubChem CID | 175557981 |
| Molecular Formula | C22H46O6 |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 406.33 |
| IUPAC Name | 7,7-dimethyloctanoic acid;5-(4-hydroxy-2-methylpentyl)peroxy-4-methylpentan-2-ol |
| SMILES | CC(C)(C)CCCCCC(=O)O.CC(O)CC(C)COOCC(C)CC(C)O |
| InChI | InChI=1S/C12H26O4.C10H20O2/c1-9(5-11(3)13)7-15-16-8-10(2)6-12(4)14;1-10(2,3)8-6-4-5-7-9(11)12/h9-14H,5-8H2,1-4H3;4-8H2,1-3H3,(H,11,12) |
| InChIKey | KAIMIMMRJZBUIU-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.60 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|