C19H42NO3+ — CID 174894299
7,7-dimethyloctanoic acid;triethyl(2-hydroxypropyl)azanium (PubChem CID 174894299) has the molecular formula C19H42NO3+ and a molecular weight of 332.55 g/mol. Its IUPAC name is 7,7-dimethyloctanoic acid;triethyl(2-hydroxypropyl)azanium.
| Compound Name | 7,7-dimethyloctanoic acid;triethyl(2-hydroxypropyl)azanium |
|---|---|
| PubChem CID | 174894299 |
| Molecular Formula | C19H42NO3+ |
| Molecular Weight | 332.55 g/mol |
| Exact Mass | 332.32 |
| IUPAC Name | 7,7-dimethyloctanoic acid;triethyl(2-hydroxypropyl)azanium |
| SMILES | CC(C)(C)CCCCCC(=O)O.CC[N+](CC)(CC)CC(C)O |
| InChI | InChI=1S/C10H20O2.C9H22NO/c1-10(2,3)8-6-4-5-7-9(11)12;1-5-10(6-2,7-3)8-9(4)11/h4-8H2,1-3H3,(H,11,12);9,11H,5-8H2,1-4H3/q;+1 |
| InChIKey | OSXQNJYCHFJYPS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.55 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|