C15H26O6 — CID 167276105
5-(2,4-dimethyl-4-propan-2-yloxypentan-2-yl)oxy-4,5-dioxopentanoic acid (PubChem CID 167276105) has the molecular formula C15H26O6 and a molecular weight of 302.37 g/mol. Its IUPAC name is 5-(2,4-dimethyl-4-propan-2-yloxypentan-2-yl)oxy-4,5-dioxopentanoic acid.
| Compound Name | 5-(2,4-dimethyl-4-propan-2-yloxypentan-2-yl)oxy-4,5-dioxopentanoic acid |
|---|---|
| PubChem CID | 167276105 |
| Molecular Formula | C15H26O6 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 5-(2,4-dimethyl-4-propan-2-yloxypentan-2-yl)oxy-4,5-dioxopentanoic acid |
| SMILES | CC(C)OC(C)(C)CC(C)(C)OC(=O)C(=O)CCC(=O)O |
| InChI | InChI=1S/C15H26O6/c1-10(2)20-14(3,4)9-15(5,6)21-13(19)11(16)7-8-12(17)18/h10H,7-9H2,1-6H3,(H,17,18) |
| InChIKey | IANSBRVYDGHZEJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|