About 2-acetyl-3-oxo-2-propan-2-yloxybutanoic acid;alumane
2-acetyl-3-oxo-2-propan-2-yloxybutanoic acid;alumane (PubChem CID 175090466) has the molecular formula C9H17AlO5
and a molecular weight of 232.21 g/mol. Its IUPAC name is 2-acetyl-3-oxo-2-propan-2-yloxybutanoic acid;alumane.
Molecular Properties
| Compound Name | 2-acetyl-3-oxo-2-propan-2-yloxybutanoic acid;alumane |
| PubChem CID | 175090466 |
| Molecular Formula | C9H17AlO5 |
| Molecular Weight | 232.21 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 2-acetyl-3-oxo-2-propan-2-yloxybutanoic acid;alumane |
| SMILES | CC(=O)C(OC(C)C)(C(C)=O)C(=O)O.[AlH3] |
| InChI | InChI=1S/C9H14O5.Al.3H/c1-5(2)14-9(6(3)10,7(4)11)8(12)13;;;;/h5H,1-4H3,(H,12,13);;;; |
| InChIKey | NCVXJNFAEGXPCQ-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.21 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-acetyl-3-oxo-2-propan-2-yloxybutanoic acid;alumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyl-3-oxo-2-propan-2-yloxybutanoic acid;alumane?
The IUPAC name of 2-acetyl-3-oxo-2-propan-2-yloxybutanoic acid;alumane (CID 175090466) is 2-acetyl-3-oxo-2-propan-2-yloxybutanoic acid;alumane.
What is the SMILES notation for 2-acetyl-3-oxo-2-propan-2-yloxybutanoic acid;alumane?
The canonical SMILES for 2-acetyl-3-oxo-2-propan-2-yloxybutanoic acid;alumane is CC(=O)C(OC(C)C)(C(C)=O)C(=O)O.[AlH3].
What is the InChIKey of 2-acetyl-3-oxo-2-propan-2-yloxybutanoic acid;alumane?
The InChIKey is NCVXJNFAEGXPCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O5.Al.3H/c1-5(2)14-9(6(3)10,7(4)11)8(12)13;;;;/h5H,1-4H3,(H,12,13);;;;.
What are the key properties of 2-acetyl-3-oxo-2-propan-2-yloxybutanoic acid;alumane?
2-acetyl-3-oxo-2-propan-2-yloxybutanoic acid;alumane has a molecular weight of 232.21 g/mol, XLogP of -0.77, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyl-3-oxo-2-propan-2-yloxybutanoic acid;alumane is sourced from PubChem (CID 175090466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).