About (4-methoxy-2-methylbutan-2-yl) 2,2,4,4-tetramethylpentanoate
(4-methoxy-2-methylbutan-2-yl) 2,2,4,4-tetramethylpentanoate (PubChem CID 137404264) has the molecular formula C15H30O3
and a molecular weight of 258.40 g/mol. Its IUPAC name is (4-methoxy-2-methylbutan-2-yl) 2,2,4,4-tetramethylpentanoate.
Analyze (4-methoxy-2-methylbutan-2-yl) 2,2,4,4-tetramethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxy-2-methylbutan-2-yl) 2,2,4,4-tetramethylpentanoate?
The IUPAC name of (4-methoxy-2-methylbutan-2-yl) 2,2,4,4-tetramethylpentanoate (CID 137404264) is (4-methoxy-2-methylbutan-2-yl) 2,2,4,4-tetramethylpentanoate.
What is the SMILES notation for (4-methoxy-2-methylbutan-2-yl) 2,2,4,4-tetramethylpentanoate?
The canonical SMILES for (4-methoxy-2-methylbutan-2-yl) 2,2,4,4-tetramethylpentanoate is COCCC(C)(C)OC(=O)C(C)(C)CC(C)(C)C.
What is the InChIKey of (4-methoxy-2-methylbutan-2-yl) 2,2,4,4-tetramethylpentanoate?
The InChIKey is QFSHDCNYHNTWFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O3/c1-13(2,3)11-14(4,5)12(16)18-15(6,7)9-10-17-8/h9-11H2,1-8H3.
What are the key properties of (4-methoxy-2-methylbutan-2-yl) 2,2,4,4-tetramethylpentanoate?
(4-methoxy-2-methylbutan-2-yl) 2,2,4,4-tetramethylpentanoate has a molecular weight of 258.40 g/mol, XLogP of 3.81, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxy-2-methylbutan-2-yl) 2,2,4,4-tetramethylpentanoate is sourced from PubChem (CID 137404264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).