C10H20O4 — CID 88896989
[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] hydrogen carbonate (PubChem CID 88896989) has the molecular formula C10H20O4 and a molecular weight of 204.27 g/mol. Its IUPAC name is [2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] hydrogen carbonate.
| Compound Name | [2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 88896989 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | [2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] hydrogen carbonate |
| SMILES | CC(C)(C)OCCC(C)(C)OC(=O)O |
| InChI | InChI=1S/C10H20O4/c1-9(2,3)13-7-6-10(4,5)14-8(11)12/h6-7H2,1-5H3,(H,11,12) |
| InChIKey | RLUKCEPTOIMWMJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |