C14H28O4S — CID 155228839
3-[2-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxyethylsulfanyl]propanoic acid (PubChem CID 155228839) has the molecular formula C14H28O4S and a molecular weight of 292.44 g/mol. Its IUPAC name is 3-[2-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxyethylsulfanyl]propanoic acid.
| Compound Name | 3-[2-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxyethylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 155228839 |
| Molecular Formula | C14H28O4S |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 3-[2-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxyethylsulfanyl]propanoic acid |
| SMILES | CC(C)(C)OCCC(C)(C)OCCSCCC(=O)O |
| InChI | InChI=1S/C14H28O4S/c1-13(2,3)17-8-7-14(4,5)18-9-11-19-10-6-12(15)16/h6-11H2,1-5H3,(H,15,16) |
| InChIKey | LUNFJWQDTPAPHG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|