C12H24O5 — CID 166655528
3-[3-(2-hydroxyethoxy)-3-methylbutoxy]-3-methylbutanoic acid (PubChem CID 166655528) has the molecular formula C12H24O5 and a molecular weight of 248.32 g/mol. Its IUPAC name is 3-[3-(2-hydroxyethoxy)-3-methylbutoxy]-3-methylbutanoic acid.
| Compound Name | 3-[3-(2-hydroxyethoxy)-3-methylbutoxy]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 166655528 |
| Molecular Formula | C12H24O5 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 3-[3-(2-hydroxyethoxy)-3-methylbutoxy]-3-methylbutanoic acid |
| SMILES | CC(C)(CCOC(C)(C)CC(=O)O)OCCO |
| InChI | InChI=1S/C12H24O5/c1-11(2,17-8-6-13)5-7-16-12(3,4)9-10(14)15/h13H,5-9H2,1-4H3,(H,14,15) |
| InChIKey | PPYXRPIDSYJQBO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |