C14H30O4 — CID 123708983
4-[3-(2-hydroxyethoxy)-3-methylbutoxy]-4-methylhexan-1-ol (PubChem CID 123708983) has the molecular formula C14H30O4 and a molecular weight of 262.39 g/mol. Its IUPAC name is 4-[3-(2-hydroxyethoxy)-3-methylbutoxy]-4-methylhexan-1-ol.
| Compound Name | 4-[3-(2-hydroxyethoxy)-3-methylbutoxy]-4-methylhexan-1-ol |
|---|---|
| PubChem CID | 123708983 |
| Molecular Formula | C14H30O4 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.21 |
| IUPAC Name | 4-[3-(2-hydroxyethoxy)-3-methylbutoxy]-4-methylhexan-1-ol |
| SMILES | CCC(C)(CCCO)OCCC(C)(C)OCCO |
| InChI | InChI=1S/C14H30O4/c1-5-14(4,7-6-9-15)18-11-8-13(2,3)17-12-10-16/h15-16H,5-12H2,1-4H3 |
| InChIKey | XVFSCRGURQIQIC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |