C15H34N2O2 — CID 90861062
4-[3-(3-aminopropoxy)-3-methylbutoxy]-4-methylhexan-1-amine (PubChem CID 90861062) has the molecular formula C15H34N2O2 and a molecular weight of 274.45 g/mol. Its IUPAC name is 4-[3-(3-aminopropoxy)-3-methylbutoxy]-4-methylhexan-1-amine.
| Compound Name | 4-[3-(3-aminopropoxy)-3-methylbutoxy]-4-methylhexan-1-amine |
|---|---|
| PubChem CID | 90861062 |
| Molecular Formula | C15H34N2O2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.26 |
| IUPAC Name | 4-[3-(3-aminopropoxy)-3-methylbutoxy]-4-methylhexan-1-amine |
| SMILES | CCC(C)(CCCN)OCCC(C)(C)OCCCN |
| InChI | InChI=1S/C15H34N2O2/c1-5-15(4,8-6-10-16)19-13-9-14(2,3)18-12-7-11-17/h5-13,16-17H2,1-4H3 |
| InChIKey | LACNMCFBGNKHHA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|