C23H48O7 — CID 134254438
4-[4-[3-[2-hydroxy-3-(4-hydroxybutoxy)propoxy]propoxy]-4-methylhexoxy]-4-methylpentan-1-ol (PubChem CID 134254438) has the molecular formula C23H48O7 and a molecular weight of 436.63 g/mol. Its IUPAC name is 4-[4-[3-[2-hydroxy-3-(4-hydroxybutoxy)propoxy]propoxy]-4-methylhexoxy]-4-methylpentan-1-ol.
| Compound Name | 4-[4-[3-[2-hydroxy-3-(4-hydroxybutoxy)propoxy]propoxy]-4-methylhexoxy]-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 134254438 |
| Molecular Formula | C23H48O7 |
| Molecular Weight | 436.63 g/mol |
| Exact Mass | 436.34 |
| IUPAC Name | 4-[4-[3-[2-hydroxy-3-(4-hydroxybutoxy)propoxy]propoxy]-4-methylhexoxy]-4-methylpentan-1-ol |
| SMILES | CCC(C)(CCCOC(C)(C)CCCO)OCCCOCC(O)COCCCCO |
| InChI | InChI=1S/C23H48O7/c1-5-23(4,12-9-17-29-22(2,3)11-8-14-25)30-18-10-16-28-20-21(26)19-27-15-7-6-13-24/h21,24-26H,5-20H2,1-4H3 |
| InChIKey | SFBOPCKBBHIMFF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.63 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|