About 7-[7-(6-hydroxyhexoxy)-3,7-dimethyloctoxy]-3,7-dimethyloctan-1-ol
7-[7-(6-hydroxyhexoxy)-3,7-dimethyloctoxy]-3,7-dimethyloctan-1-ol (PubChem CID 155653781) has the molecular formula C26H54O4
and a molecular weight of 430.71 g/mol. Its IUPAC name is 7-[7-(6-hydroxyhexoxy)-3,7-dimethyloctoxy]-3,7-dimethyloctan-1-ol.
Molecular Properties
| Compound Name | 7-[7-(6-hydroxyhexoxy)-3,7-dimethyloctoxy]-3,7-dimethyloctan-1-ol |
| PubChem CID | 155653781 |
| Molecular Formula | C26H54O4 |
| Molecular Weight | 430.71 g/mol |
| Exact Mass | 430.40 |
| IUPAC Name | 7-[7-(6-hydroxyhexoxy)-3,7-dimethyloctoxy]-3,7-dimethyloctan-1-ol |
| SMILES | CC(CCO)CCCC(C)(C)OCCC(C)CCCC(C)(C)OCCCCCCO |
| InChI | InChI=1S/C26H54O4/c1-23(15-20-28)13-11-18-26(5,6)30-22-16-24(2)14-12-17-25(3,4)29-21-10-8-7-9-19-27/h23-24,27-28H,7-22H2,1-6H3 |
| InChIKey | RVAGSQUWIWJJCI-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.71 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-[7-(6-hydroxyhexoxy)-3,7-dimethyloctoxy]-3,7-dimethyloctan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[7-(6-hydroxyhexoxy)-3,7-dimethyloctoxy]-3,7-dimethyloctan-1-ol?
The IUPAC name of 7-[7-(6-hydroxyhexoxy)-3,7-dimethyloctoxy]-3,7-dimethyloctan-1-ol (CID 155653781) is 7-[7-(6-hydroxyhexoxy)-3,7-dimethyloctoxy]-3,7-dimethyloctan-1-ol.
What is the SMILES notation for 7-[7-(6-hydroxyhexoxy)-3,7-dimethyloctoxy]-3,7-dimethyloctan-1-ol?
The canonical SMILES for 7-[7-(6-hydroxyhexoxy)-3,7-dimethyloctoxy]-3,7-dimethyloctan-1-ol is CC(CCO)CCCC(C)(C)OCCC(C)CCCC(C)(C)OCCCCCCO.
What is the InChIKey of 7-[7-(6-hydroxyhexoxy)-3,7-dimethyloctoxy]-3,7-dimethyloctan-1-ol?
The InChIKey is RVAGSQUWIWJJCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H54O4/c1-23(15-20-28)13-11-18-26(5,6)30-22-16-24(2)14-12-17-25(3,4)29-21-10-8-7-9-19-27/h23-24,27-28H,7-22H2,1-6H3.
What are the key properties of 7-[7-(6-hydroxyhexoxy)-3,7-dimethyloctoxy]-3,7-dimethyloctan-1-ol?
7-[7-(6-hydroxyhexoxy)-3,7-dimethyloctoxy]-3,7-dimethyloctan-1-ol has a molecular weight of 430.71 g/mol, XLogP of 6.51, 21 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[7-(6-hydroxyhexoxy)-3,7-dimethyloctoxy]-3,7-dimethyloctan-1-ol is sourced from PubChem (CID 155653781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).