C26H54O4 — CID 155653781
7-[7-(6-hydroxyhexoxy)-3,7-dimethyloctoxy]-3,7-dimethyloctan-1-ol (PubChem CID 155653781) has the molecular formula C26H54O4 and a molecular weight of 430.71 g/mol. Its IUPAC name is 7-[7-(6-hydroxyhexoxy)-3,7-dimethyloctoxy]-3,7-dimethyloctan-1-ol.
| Compound Name | 7-[7-(6-hydroxyhexoxy)-3,7-dimethyloctoxy]-3,7-dimethyloctan-1-ol |
|---|---|
| PubChem CID | 155653781 |
| Molecular Formula | C26H54O4 |
| Molecular Weight | 430.71 g/mol |
| Exact Mass | 430.40 |
| IUPAC Name | 7-[7-(6-hydroxyhexoxy)-3,7-dimethyloctoxy]-3,7-dimethyloctan-1-ol |
| SMILES | CC(CCO)CCCC(C)(C)OCCC(C)CCCC(C)(C)OCCCCCCO |
| InChI | InChI=1S/C26H54O4/c1-23(15-20-28)13-11-18-26(5,6)30-22-16-24(2)14-12-17-25(3,4)29-21-10-8-7-9-19-27/h23-24,27-28H,7-22H2,1-6H3 |
| InChIKey | RVAGSQUWIWJJCI-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.71 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|