About 6-hydroxyhexyl (5-hydroxy-3-methylpentyl) carbonate;4-methoxybutan-1-ol
6-hydroxyhexyl (5-hydroxy-3-methylpentyl) carbonate;4-methoxybutan-1-ol (PubChem CID 160539409) has the molecular formula C18H38O7
and a molecular weight of 366.50 g/mol. Its IUPAC name is 6-hydroxyhexyl (5-hydroxy-3-methylpentyl) carbonate;4-methoxybutan-1-ol.
Molecular Properties
| Compound Name | 6-hydroxyhexyl (5-hydroxy-3-methylpentyl) carbonate;4-methoxybutan-1-ol |
| PubChem CID | 160539409 |
| Molecular Formula | C18H38O7 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | 6-hydroxyhexyl (5-hydroxy-3-methylpentyl) carbonate;4-methoxybutan-1-ol |
| SMILES | CC(CCO)CCOC(=O)OCCCCCCO.COCCCCO |
| InChI | InChI=1S/C13H26O5.C5H12O2/c1-12(6-9-15)7-11-18-13(16)17-10-5-3-2-4-8-14;1-7-5-3-2-4-6/h12,14-15H,2-11H2,1H3;6H,2-5H2,1H3 |
| InChIKey | QWOVIXPRLXSBSA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxyhexyl (5-hydroxy-3-methylpentyl) carbonate;4-methoxybutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxyhexyl (5-hydroxy-3-methylpentyl) carbonate;4-methoxybutan-1-ol?
The IUPAC name of 6-hydroxyhexyl (5-hydroxy-3-methylpentyl) carbonate;4-methoxybutan-1-ol (CID 160539409) is 6-hydroxyhexyl (5-hydroxy-3-methylpentyl) carbonate;4-methoxybutan-1-ol.
What is the SMILES notation for 6-hydroxyhexyl (5-hydroxy-3-methylpentyl) carbonate;4-methoxybutan-1-ol?
The canonical SMILES for 6-hydroxyhexyl (5-hydroxy-3-methylpentyl) carbonate;4-methoxybutan-1-ol is CC(CCO)CCOC(=O)OCCCCCCO.COCCCCO.
What is the InChIKey of 6-hydroxyhexyl (5-hydroxy-3-methylpentyl) carbonate;4-methoxybutan-1-ol?
The InChIKey is QWOVIXPRLXSBSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O5.C5H12O2/c1-12(6-9-15)7-11-18-13(16)17-10-5-3-2-4-8-14;1-7-5-3-2-4-6/h12,14-15H,2-11H2,1H3;6H,2-5H2,1H3.
What are the key properties of 6-hydroxyhexyl (5-hydroxy-3-methylpentyl) carbonate;4-methoxybutan-1-ol?
6-hydroxyhexyl (5-hydroxy-3-methylpentyl) carbonate;4-methoxybutan-1-ol has a molecular weight of 366.50 g/mol, XLogP of 2.51, 15 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxyhexyl (5-hydroxy-3-methylpentyl) carbonate;4-methoxybutan-1-ol is sourced from PubChem (CID 160539409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).