C32H62O7 — CID 154973162
[7-(5-hydroxy-5-methylhexoxy)-2,7-dimethyloctan-2-yl] 7-(6-hydroxyhexanoyloxy)-7-methyloctanoate (PubChem CID 154973162) has the molecular formula C32H62O7 and a molecular weight of 558.84 g/mol. Its IUPAC name is [7-(5-hydroxy-5-methylhexoxy)-2,7-dimethyloctan-2-yl] 7-(6-hydroxyhexanoyloxy)-7-methyloctanoate.
| Compound Name | [7-(5-hydroxy-5-methylhexoxy)-2,7-dimethyloctan-2-yl] 7-(6-hydroxyhexanoyloxy)-7-methyloctanoate |
|---|---|
| PubChem CID | 154973162 |
| Molecular Formula | C32H62O7 |
| Molecular Weight | 558.84 g/mol |
| Exact Mass | 558.45 |
| IUPAC Name | [7-(5-hydroxy-5-methylhexoxy)-2,7-dimethyloctan-2-yl] 7-(6-hydroxyhexanoyloxy)-7-methyloctanoate |
| SMILES | CC(C)(O)CCCCOC(C)(C)CCCCC(C)(C)OC(=O)CCCCCC(C)(C)OC(=O)CCCCCO |
| InChI | InChI=1S/C32H62O7/c1-29(2,36)21-16-18-26-37-30(3,4)22-14-15-24-32(7,8)39-27(34)19-11-9-13-23-31(5,6)38-28(35)20-12-10-17-25-33/h33,36H,9-26H2,1-8H3 |
| InChIKey | QXRCEWXWFBNNAM-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.84 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|