C17H30O5 — CID 129212226
(2-methyl-4-prop-2-enoyloxybutan-2-yl) 7-hydroxy-7-methyloctanoate (PubChem CID 129212226) has the molecular formula C17H30O5 and a molecular weight of 314.42 g/mol. Its IUPAC name is (2-methyl-4-prop-2-enoyloxybutan-2-yl) 7-hydroxy-7-methyloctanoate.
| Compound Name | (2-methyl-4-prop-2-enoyloxybutan-2-yl) 7-hydroxy-7-methyloctanoate |
|---|---|
| PubChem CID | 129212226 |
| Molecular Formula | C17H30O5 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | (2-methyl-4-prop-2-enoyloxybutan-2-yl) 7-hydroxy-7-methyloctanoate |
| SMILES | C=CC(=O)OCCC(C)(C)OC(=O)CCCCCC(C)(C)O |
| InChI | InChI=1S/C17H30O5/c1-6-14(18)21-13-12-17(4,5)22-15(19)10-8-7-9-11-16(2,3)20/h6,20H,1,7-13H2,2-5H3 |
| InChIKey | JINXYRBUZZMRCK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|