C20H41NO4 — CID 139322734
[2-amino-3,3-dimethyl-5-[(2-methylpropan-2-yl)oxy]pentan-2-yl] 7-hydroxy-7-methyloctanoate (PubChem CID 139322734) has the molecular formula C20H41NO4 and a molecular weight of 359.55 g/mol. Its IUPAC name is [2-amino-3,3-dimethyl-5-[(2-methylpropan-2-yl)oxy]pentan-2-yl] 7-hydroxy-7-methyloctanoate.
| Compound Name | [2-amino-3,3-dimethyl-5-[(2-methylpropan-2-yl)oxy]pentan-2-yl] 7-hydroxy-7-methyloctanoate |
|---|---|
| PubChem CID | 139322734 |
| Molecular Formula | C20H41NO4 |
| Molecular Weight | 359.55 g/mol |
| Exact Mass | 359.30 |
| IUPAC Name | [2-amino-3,3-dimethyl-5-[(2-methylpropan-2-yl)oxy]pentan-2-yl] 7-hydroxy-7-methyloctanoate |
| SMILES | CC(C)(O)CCCCCC(=O)OC(C)(N)C(C)(C)CCOC(C)(C)C |
| InChI | InChI=1S/C20H41NO4/c1-17(2,3)24-15-14-18(4,5)20(8,21)25-16(22)12-10-9-11-13-19(6,7)23/h23H,9-15,21H2,1-8H3 |
| InChIKey | YJWOQFPRVUIYQY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.55 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|