About [2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] (E)-tetradec-9-enoate
[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] (E)-tetradec-9-enoate (PubChem CID 87726601) has the molecular formula C23H44O3
and a molecular weight of 368.60 g/mol. Its IUPAC name is [2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] (E)-tetradec-9-enoate.
Molecular Properties
| Compound Name | [2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] (E)-tetradec-9-enoate |
| PubChem CID | 87726601 |
| Molecular Formula | C23H44O3 |
| Molecular Weight | 368.60 g/mol |
| Exact Mass | 368.33 |
| IUPAC Name | [2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] (E)-tetradec-9-enoate |
| SMILES | CCCC/C=C/CCCCCCCC(=O)OC(C)(C)CCOC(C)(C)C |
| InChI | InChI=1S/C23H44O3/c1-7-8-9-10-11-12-13-14-15-16-17-18-21(24)26-23(5,6)19-20-25-22(2,3)4/h10-11H,7-9,12-20H2,1-6H3/b11-10+ |
| InChIKey | KCUWOGLWYJZWFX-ZHACJKMWSA-N |
| XLogP | 6.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.60 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] (E)-tetradec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] (E)-tetradec-9-enoate?
The IUPAC name of [2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] (E)-tetradec-9-enoate (CID 87726601) is [2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] (E)-tetradec-9-enoate.
What is the SMILES notation for [2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] (E)-tetradec-9-enoate?
The canonical SMILES for [2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] (E)-tetradec-9-enoate is CCCC/C=C/CCCCCCCC(=O)OC(C)(C)CCOC(C)(C)C.
What is the InChIKey of [2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] (E)-tetradec-9-enoate?
The InChIKey is KCUWOGLWYJZWFX-ZHACJKMWSA-N. The full InChI is InChI=1S/C23H44O3/c1-7-8-9-10-11-12-13-14-15-16-17-18-21(24)26-23(5,6)19-20-25-22(2,3)4/h10-11H,7-9,12-20H2,1-6H3/b11-10+.
What are the key properties of [2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] (E)-tetradec-9-enoate?
[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] (E)-tetradec-9-enoate has a molecular weight of 368.60 g/mol, XLogP of 6.99, 15 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl] (E)-tetradec-9-enoate is sourced from PubChem (CID 87726601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).