C61H112O6 — CID 11193911
[2-[(E)-octadec-9-enoyl]oxy-2-[[(E)-octadec-9-enoyl]oxymethyl]hexyl] (Z)-octadec-9-enoate (PubChem CID 11193911) has the molecular formula C61H112O6 and a molecular weight of 941.56 g/mol. Its IUPAC name is [2-[(E)-octadec-9-enoyl]oxy-2-[[(E)-octadec-9-enoyl]oxymethyl]hexyl] (Z)-octadec-9-enoate.
| Compound Name | [2-[(E)-octadec-9-enoyl]oxy-2-[[(E)-octadec-9-enoyl]oxymethyl]hexyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 11193911 |
| Molecular Formula | C61H112O6 |
| Molecular Weight | 941.56 g/mol |
| Exact Mass | 940.85 |
| IUPAC Name | [2-[(E)-octadec-9-enoyl]oxy-2-[[(E)-octadec-9-enoyl]oxymethyl]hexyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(CCCC)(COC(=O)CCCCCCC/C=C/CCCCCCCC)OC(=O)CCCCCCC/C=C/CCCCCCCC |
| InChI | InChI=1S/C61H112O6/c1-5-9-13-16-19-22-25-28-31-34-37-40-43-46-49-52-58(62)65-56-61(55-12-8-4,67-60(64)54-51-48-45-42-39-36-33-30-27-24-21-18-15-11-7-3)57-66-59(63)53-50-47-44-41-38-35-32-29-26-23-20-17-14-10-6-2/h28-33H,5-27,34-57H2,1-4H3/b31-28-,32-29+,33-30+ |
| InChIKey | WQGSIXUICYLJGE-NAEKIHPQSA-N |
| XLogP | 19.66 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 53 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 941.56 |
| LogP ≤ 5 | 19.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|