C26H52O2 — CID 162304034
10-[2,6-dimethyl-8-[(2-methylpropan-2-yl)oxy]octan-2-yl]oxy-2,6-dimethyldec-1-ene (PubChem CID 162304034) has the molecular formula C26H52O2 and a molecular weight of 396.70 g/mol. Its IUPAC name is 10-[2,6-dimethyl-8-[(2-methylpropan-2-yl)oxy]octan-2-yl]oxy-2,6-dimethyldec-1-ene.
| Compound Name | 10-[2,6-dimethyl-8-[(2-methylpropan-2-yl)oxy]octan-2-yl]oxy-2,6-dimethyldec-1-ene |
|---|---|
| PubChem CID | 162304034 |
| Molecular Formula | C26H52O2 |
| Molecular Weight | 396.70 g/mol |
| Exact Mass | 396.40 |
| IUPAC Name | 10-[2,6-dimethyl-8-[(2-methylpropan-2-yl)oxy]octan-2-yl]oxy-2,6-dimethyldec-1-ene |
| SMILES | C=C(C)CCCC(C)CCCCOC(C)(C)CCCC(C)CCOC(C)(C)C |
| InChI | InChI=1S/C26H52O2/c1-22(2)14-12-16-23(3)15-10-11-20-28-26(8,9)19-13-17-24(4)18-21-27-25(5,6)7/h23-24H,1,10-21H2,2-9H3 |
| InChIKey | IIDZANVOSZKPEU-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.70 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|