About 10-[2,6-dimethyl-8-[(2-methylpropan-2-yl)oxy]octan-2-yl]oxy-2,6-dimethyldec-1-ene
10-[2,6-dimethyl-8-[(2-methylpropan-2-yl)oxy]octan-2-yl]oxy-2,6-dimethyldec-1-ene (PubChem CID 162304034) has the molecular formula C26H52O2
and a molecular weight of 396.70 g/mol. Its IUPAC name is 10-[2,6-dimethyl-8-[(2-methylpropan-2-yl)oxy]octan-2-yl]oxy-2,6-dimethyldec-1-ene.
Molecular Properties
| Compound Name | 10-[2,6-dimethyl-8-[(2-methylpropan-2-yl)oxy]octan-2-yl]oxy-2,6-dimethyldec-1-ene |
| PubChem CID | 162304034 |
| Molecular Formula | C26H52O2 |
| Molecular Weight | 396.70 g/mol |
| Exact Mass | 396.40 |
| IUPAC Name | 10-[2,6-dimethyl-8-[(2-methylpropan-2-yl)oxy]octan-2-yl]oxy-2,6-dimethyldec-1-ene |
| SMILES | C=C(C)CCCC(C)CCCCOC(C)(C)CCCC(C)CCOC(C)(C)C |
| InChI | InChI=1S/C26H52O2/c1-22(2)14-12-16-23(3)15-10-11-20-28-26(8,9)19-13-17-24(4)18-21-27-25(5,6)7/h23-24H,1,10-21H2,2-9H3 |
| InChIKey | IIDZANVOSZKPEU-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.70 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 10-[2,6-dimethyl-8-[(2-methylpropan-2-yl)oxy]octan-2-yl]oxy-2,6-dimethyldec-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-[2,6-dimethyl-8-[(2-methylpropan-2-yl)oxy]octan-2-yl]oxy-2,6-dimethyldec-1-ene?
The IUPAC name of 10-[2,6-dimethyl-8-[(2-methylpropan-2-yl)oxy]octan-2-yl]oxy-2,6-dimethyldec-1-ene (CID 162304034) is 10-[2,6-dimethyl-8-[(2-methylpropan-2-yl)oxy]octan-2-yl]oxy-2,6-dimethyldec-1-ene.
What is the SMILES notation for 10-[2,6-dimethyl-8-[(2-methylpropan-2-yl)oxy]octan-2-yl]oxy-2,6-dimethyldec-1-ene?
The canonical SMILES for 10-[2,6-dimethyl-8-[(2-methylpropan-2-yl)oxy]octan-2-yl]oxy-2,6-dimethyldec-1-ene is C=C(C)CCCC(C)CCCCOC(C)(C)CCCC(C)CCOC(C)(C)C.
What is the InChIKey of 10-[2,6-dimethyl-8-[(2-methylpropan-2-yl)oxy]octan-2-yl]oxy-2,6-dimethyldec-1-ene?
The InChIKey is IIDZANVOSZKPEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H52O2/c1-22(2)14-12-16-23(3)15-10-11-20-28-26(8,9)19-13-17-24(4)18-21-27-25(5,6)7/h23-24H,1,10-21H2,2-9H3.
What are the key properties of 10-[2,6-dimethyl-8-[(2-methylpropan-2-yl)oxy]octan-2-yl]oxy-2,6-dimethyldec-1-ene?
10-[2,6-dimethyl-8-[(2-methylpropan-2-yl)oxy]octan-2-yl]oxy-2,6-dimethyldec-1-ene has a molecular weight of 396.70 g/mol, XLogP of 8.35, 17 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-[2,6-dimethyl-8-[(2-methylpropan-2-yl)oxy]octan-2-yl]oxy-2,6-dimethyldec-1-ene is sourced from PubChem (CID 162304034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).