C19H40O2 — CID 19888732
2-methyl-1,10-bis[(2-methylpropan-2-yl)oxy]decane (PubChem CID 19888732) has the molecular formula C19H40O2 and a molecular weight of 300.53 g/mol. Its IUPAC name is 2-methyl-1,10-bis[(2-methylpropan-2-yl)oxy]decane.
| Compound Name | 2-methyl-1,10-bis[(2-methylpropan-2-yl)oxy]decane |
|---|---|
| PubChem CID | 19888732 |
| Molecular Formula | C19H40O2 |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 300.30 |
| IUPAC Name | 2-methyl-1,10-bis[(2-methylpropan-2-yl)oxy]decane |
| SMILES | CC(CCCCCCCCOC(C)(C)C)COC(C)(C)C |
| InChI | InChI=1S/C19H40O2/c1-17(16-21-19(5,6)7)14-12-10-8-9-11-13-15-20-18(2,3)4/h17H,8-16H2,1-7H3 |
| InChIKey | PDKAKJUZHFIALN-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|