About (2R)-2,4-dimethyl-1-[(2-methylpropan-2-yl)oxy]pentane
(2R)-2,4-dimethyl-1-[(2-methylpropan-2-yl)oxy]pentane (PubChem CID 174384089) has the molecular formula C11H24O
and a molecular weight of 172.31 g/mol. Its IUPAC name is (2R)-2,4-dimethyl-1-[(2-methylpropan-2-yl)oxy]pentane.
Analyze (2R)-2,4-dimethyl-1-[(2-methylpropan-2-yl)oxy]pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2,4-dimethyl-1-[(2-methylpropan-2-yl)oxy]pentane?
The IUPAC name of (2R)-2,4-dimethyl-1-[(2-methylpropan-2-yl)oxy]pentane (CID 174384089) is (2R)-2,4-dimethyl-1-[(2-methylpropan-2-yl)oxy]pentane.
What is the SMILES notation for (2R)-2,4-dimethyl-1-[(2-methylpropan-2-yl)oxy]pentane?
The canonical SMILES for (2R)-2,4-dimethyl-1-[(2-methylpropan-2-yl)oxy]pentane is CC(C)C[C@@H](C)COC(C)(C)C.
What is the InChIKey of (2R)-2,4-dimethyl-1-[(2-methylpropan-2-yl)oxy]pentane?
The InChIKey is FRELEUUVIWZEHN-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H24O/c1-9(2)7-10(3)8-12-11(4,5)6/h9-10H,7-8H2,1-6H3/t10-/m1/s1.
What are the key properties of (2R)-2,4-dimethyl-1-[(2-methylpropan-2-yl)oxy]pentane?
(2R)-2,4-dimethyl-1-[(2-methylpropan-2-yl)oxy]pentane has a molecular weight of 172.31 g/mol, XLogP of 3.48, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2,4-dimethyl-1-[(2-methylpropan-2-yl)oxy]pentane is sourced from PubChem (CID 174384089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).